Thermodynamics

Hess's Law: Calculating Enthalpy Changes Indirectly

Master Hess's Law to calculate enthalpy changes for reactions that cannot be measured directly. Includes energy cycle construction, worked examples with formation and combustion data, and exam-ready strategies.

V
Vectora Team
STEM Education
10 min read
2026-01-08

What Is Hess's Law?

Hess's Law states that the total enthalpy change for a chemical reaction is independent of the route taken, provided the initial and final conditions are the same. This is a direct consequence of enthalpy being a state function.

In practice, Hess's Law lets us calculate the enthalpy change (ΔH\Delta H) for a reaction that is difficult or impossible to measure directly, by constructing an energy cycle through intermediate steps whose enthalpy changes are known.

Learning Goals: By the end of this guide, you should be able to:

  1. State Hess's Law and explain why it works.
  2. Construct energy cycles using standard enthalpies of formation or combustion.
  3. Calculate unknown ΔH\Delta H values from tabulated data.
  4. Apply Hess's Law to multi-step industrial and biological processes.

The Two Key Formulas

Using Standard Enthalpies of Formation (ΔfH°\Delta_f H°)

ΔrH°=ΔfH°(products)ΔfH°(reactants)\Delta_r H° = \sum \Delta_f H°(\text{products}) - \sum \Delta_f H°(\text{reactants})

The standard enthalpy of formation of any element in its standard state is zero by definition.

Using Standard Enthalpies of Combustion (ΔcH°\Delta_c H°)

ΔrH°=ΔcH°(reactants)ΔcH°(products)\Delta_r H° = \sum \Delta_c H°(\text{reactants}) - \sum \Delta_c H°(\text{products})

Note the subtraction is reversed compared to the formation formula — reactants minus products.

MethodData usedSubtraction order
Formation routeΔfH°\Delta_f H°Products − Reactants
Combustion routeΔcH°\Delta_c H°Reactants − Products

Energy Cycle Construction

Step 1: Write the target reaction

C(s)+2H2(g)CH4(g)ΔfH°=?C(s) + 2H_2(g) \rightarrow CH_4(g) \quad \Delta_f H° = ?

Step 2: Identify alternate routes via combustion

All reactants and products can be burned to form CO2CO_2 and H2OH_2O:

  • C(s)+O2(g)CO2(g)C(s) + O_2(g) \rightarrow CO_2(g)ΔcH°=393 kJ/mol\Delta_c H° = -393\ kJ/mol
  • H2(g)+12O2(g)H2O(l)H_2(g) + \frac{1}{2}O_2(g) \rightarrow H_2O(l)ΔcH°=286 kJ/mol\Delta_c H° = -286\ kJ/mol
  • CH4(g)+2O2(g)CO2(g)+2H2O(l)CH_4(g) + 2O_2(g) \rightarrow CO_2(g) + 2H_2O(l)ΔcH°=890 kJ/mol\Delta_c H° = -890\ kJ/mol

Step 3: Apply Hess's Law

ΔfH°(CH4)=ΔcH°(C)+2×ΔcH°(H2)ΔcH°(CH4)\Delta_f H°(CH_4) = \Delta_c H°(C) + 2 \times \Delta_c H°(H_2) - \Delta_c H°(CH_4) =(393)+2(286)(890)=393572+890=75 kJ/mol= (-393) + 2(-286) - (-890) = -393 - 572 + 890 = -75\ kJ/mol

Worked Examples

Example 1: Enthalpy of Formation of Ethanol

Calculate ΔfH°\Delta_f H° for C2H5OH(l)C_2H_5OH(l) given:

SubstanceΔcH°\Delta_c H° (kJ/mol)
C(s)C(s)393-393
H2(g)H_2(g)286-286
C2H5OH(l)C_2H_5OH(l)1367-1367

Target: 2C(s)+3H2(g)+12O2(g)C2H5OH(l)2C(s) + 3H_2(g) + \frac{1}{2}O_2(g) \rightarrow C_2H_5OH(l)

ΔfH°=2(393)+3(286)(1367)\Delta_f H° = 2(-393) + 3(-286) - (-1367) =786858+1367=277 kJ/mol= -786 - 858 + 1367 = -277\ kJ/mol

Example 2: Using Formation Data

Calculate ΔrH°\Delta_r H° for the thermite reaction:

2Al(s)+Fe2O3(s)Al2O3(s)+2Fe(s)2Al(s) + Fe_2O_3(s) \rightarrow Al_2O_3(s) + 2Fe(s)

Given: ΔfH°(Fe2O3)=824 kJ/mol\Delta_f H°(Fe_2O_3) = -824\ kJ/mol, ΔfH°(Al2O3)=1676 kJ/mol\Delta_f H°(Al_2O_3) = -1676\ kJ/mol

ΔrH°=[1676+0][824+0]=1676+824=852 kJ/mol\Delta_r H° = [-1676 + 0] - [-824 + 0] = -1676 + 824 = -852\ kJ/mol

Elements in their standard states (AlAl, FeFe) have ΔfH°=0\Delta_f H° = 0.

Example 3: Multi-step Neutralisation

Calculate ΔH\Delta H for dissolving NaOH(s)NaOH(s) in water, given:

  • NaOH(s)Na+(aq)+OH(aq)NaOH(s) \rightarrow Na^+(aq) + OH^-(aq)ΔH=?\Delta H = ?
  • NaOH(s)+HCl(aq)NaCl(aq)+H2O(l)NaOH(s) + HCl(aq) \rightarrow NaCl(aq) + H_2O(l)ΔH1=76 kJ/mol\Delta H_1 = -76\ kJ/mol
  • NaOH(aq)+HCl(aq)NaCl(aq)+H2O(l)NaOH(aq) + HCl(aq) \rightarrow NaCl(aq) + H_2O(l)ΔH2=57 kJ/mol\Delta H_2 = -57\ kJ/mol

By Hess's Law: ΔH1=ΔHdissolution+ΔH2\Delta H_1 = \Delta H_{dissolution} + \Delta H_2

ΔHdissolution=76(57)=19 kJ/mol\Delta H_{dissolution} = -76 - (-57) = -19\ kJ/mol

Common Mistakes

  1. Reversing the subtraction order — For formation data it's products − reactants; for combustion data it's reactants − products. Mixing these up inverts the sign.

  2. Forgetting stoichiometric coefficients — If the balanced equation has 2 mol of H2H_2, you must multiply ΔcH°(H2)\Delta_c H°(H_2) by 2.

  3. Including elements in formation calculations — The standard enthalpy of formation of any element in its standard state is zero. Don't look up a value for O2(g)O_2(g) or C(graphite)C(\text{graphite}).

  4. Not checking the state symbolsH2O(l)H_2O(l) and H2O(g)H_2O(g) have different enthalpies. Ensure your data matches the states in the reaction.


Exam Tips (A-Level / AP / IB)

  • Always draw the energy cycle before calculating. It prevents sign errors and impresses examiners.
  • State Hess's Law in words: "The total enthalpy change is independent of the route taken, as enthalpy is a state function."
  • For IB: both the formation and combustion route formulas are in the data booklet — learn which to apply and when.
  • For AP: Hess's Law problems often give you 2-3 equations to combine algebraically. Reverse equations (flip signs) and multiply (scale enthalpies) as needed.

Frequently Asked Questions

Why does Hess's Law work?

Because enthalpy is a state function — it depends only on the initial and final states, not on the path. This is a consequence of the first law of thermodynamics (conservation of energy).

When should I use the combustion route vs the formation route?

Use whichever data you are given. If the question gives ΔcH°\Delta_c H° values, use the combustion route. If it gives ΔfH°\Delta_f H° values, use the formation route. Both give the same answer.

Can Hess's Law be applied to Gibbs free energy and entropy?

Yes! Since GG and SS are also state functions, the same principle applies: ΔrG°=ΔfG°(products)ΔfG°(reactants)\Delta_r G° = \sum \Delta_f G°(\text{products}) - \sum \Delta_f G°(\text{reactants}).